C13H19ClN2OS — CID 130476257
2-amino-1-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]ethanone;hydrochloride (PubChem CID 130476257) has the molecular formula C13H19ClN2OS and a molecular weight of 286.83 g/mol. Its IUPAC name is 2-amino-1-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-amino-1-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 130476257 |
| Molecular Formula | C13H19ClN2OS |
| Molecular Weight | 286.83 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-amino-1-[(2R)-2-(2-methylsulfanylphenyl)pyrrolidin-1-yl]ethanone;hydrochloride |
| SMILES | CSc1ccccc1[C@H]1CCCN1C(=O)CN.Cl |
| InChI | InChI=1S/C13H18N2OS.ClH/c1-17-12-7-3-2-5-10(12)11-6-4-8-15(11)13(16)9-14;/h2-3,5,7,11H,4,6,8-9,14H2,1H3;1H/t11-;/m1./s1 |
| InChIKey | QIFNLQLHTWBZNP-RFVHGSKJSA-N |
| XLogP | 2.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.83 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |