About 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one
12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one (PubChem CID 13047645) has the molecular formula C15H19BrO2
and a molecular weight of 311.22 g/mol. Its IUPAC name is 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one.
Molecular Properties
| Compound Name | 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one |
| PubChem CID | 13047645 |
| Molecular Formula | C15H19BrO2 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one |
| SMILES | O=c1c2cc(Br)cc(c1O)CCCCCCCC2 |
| InChI | InChI=1S/C15H19BrO2/c16-13-9-11-7-5-3-1-2-4-6-8-12(10-13)15(18)14(11)17/h9-10H,1-8H2,(H,17,18) |
| InChIKey | MXCGVEWCDPPUND-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one?
The IUPAC name of 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one (CID 13047645) is 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one.
What is the SMILES notation for 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one?
The canonical SMILES for 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one is O=c1c2cc(Br)cc(c1O)CCCCCCCC2.
What is the InChIKey of 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one?
The InChIKey is MXCGVEWCDPPUND-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrO2/c16-13-9-11-7-5-3-1-2-4-6-8-12(10-13)15(18)14(11)17/h9-10H,1-8H2,(H,17,18).
What are the key properties of 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one?
12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one has a molecular weight of 311.22 g/mol, XLogP of 3.95, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-bromo-15-hydroxybicyclo[8.3.2]pentadeca-1(13),10(15),11-trien-14-one is sourced from PubChem (CID 13047645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).