C21H25N3O3 — CID 130476467
2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)acetamide (PubChem CID 130476467) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)acetamide.
| Compound Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)acetamide |
|---|---|
| PubChem CID | 130476467 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]decan-4-yl)-N-(1,2,3,4-tetrahydroquinolin-6-ylmethyl)acetamide |
| SMILES | O=C(CN1C(=O)C2C3CCC(C3)C2C1=O)NCc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C21H25N3O3/c25-17(23-10-12-3-6-16-13(8-12)2-1-7-22-16)11-24-20(26)18-14-4-5-15(9-14)19(18)21(24)27/h3,6,8,14-15,18-19,22H,1-2,4-5,7,9-11H2,(H,23,25) |
| InChIKey | ABTFDUSGCSGBMO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|