C12H10F4N2O3 — CID 130476516
1-methyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazolidine-2,4-dione (PubChem CID 130476516) has the molecular formula C12H10F4N2O3 and a molecular weight of 306.21 g/mol. Its IUPAC name is 1-methyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazolidine-2,4-dione.
| Compound Name | 1-methyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 130476516 |
| Molecular Formula | C12H10F4N2O3 |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 1-methyl-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazolidine-2,4-dione |
| SMILES | CN1CC(=O)N(c2ccc(OC(F)(F)C(F)F)cc2)C1=O |
| InChI | InChI=1S/C12H10F4N2O3/c1-17-6-9(19)18(11(17)20)7-2-4-8(5-3-7)21-12(15,16)10(13)14/h2-5,10H,6H2,1H3 |
| InChIKey | QQTIJTKRNXONAQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|