C15H18O4 — CID 13047661
methyl 2-[(1R,4aR,8aR)-7,8a-dimethyl-5,8-dioxo-4,4a-dihydro-1H-naphthalen-1-yl]acetate (PubChem CID 13047661) has the molecular formula C15H18O4 and a molecular weight of 262.31 g/mol. Its IUPAC name is methyl 2-[(1R,4aR,8aR)-7,8a-dimethyl-5,8-dioxo-4,4a-dihydro-1H-naphthalen-1-yl]acetate.
| Compound Name | methyl 2-[(1R,4aR,8aR)-7,8a-dimethyl-5,8-dioxo-4,4a-dihydro-1H-naphthalen-1-yl]acetate |
|---|---|
| PubChem CID | 13047661 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl 2-[(1R,4aR,8aR)-7,8a-dimethyl-5,8-dioxo-4,4a-dihydro-1H-naphthalen-1-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C=CC[C@H]2C(=O)C=C(C)C(=O)[C@]12C |
| InChI | InChI=1S/C15H18O4/c1-9-7-12(16)11-6-4-5-10(8-13(17)19-3)15(11,2)14(9)18/h4-5,7,10-11H,6,8H2,1-3H3/t10-,11-,15+/m0/s1 |
| InChIKey | JRGCYYVDQZDHEC-ZIBATOQPSA-N |
| XLogP | 1.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|