C14H20OS2 — CID 13047885
[8a-(1,3-dithiolan-2-yl)-1,4,5,8-tetrahydronaphthalen-4a-yl]methanol (PubChem CID 13047885) has the molecular formula C14H20OS2 and a molecular weight of 268.45 g/mol. Its IUPAC name is [8a-(1,3-dithiolan-2-yl)-1,4,5,8-tetrahydronaphthalen-4a-yl]methanol.
| Compound Name | [8a-(1,3-dithiolan-2-yl)-1,4,5,8-tetrahydronaphthalen-4a-yl]methanol |
|---|---|
| PubChem CID | 13047885 |
| Molecular Formula | C14H20OS2 |
| Molecular Weight | 268.45 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [8a-(1,3-dithiolan-2-yl)-1,4,5,8-tetrahydronaphthalen-4a-yl]methanol |
| SMILES | OCC12CC=CCC1(C1SCCS1)CC=CC2 |
| InChI | InChI=1S/C14H20OS2/c15-11-13-5-1-3-7-14(13,8-4-2-6-13)12-16-9-10-17-12/h1-4,12,15H,5-11H2 |
| InChIKey | XQPJTFFDWOAXEE-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.45 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|