About 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene
3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene (PubChem CID 130478932) has the molecular formula C13H19Cl
and a molecular weight of 210.75 g/mol. Its IUPAC name is 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene.
Molecular Properties
| Compound Name | 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene |
| PubChem CID | 130478932 |
| Molecular Formula | C13H19Cl |
| Molecular Weight | 210.75 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene |
| SMILES | CC(C)(C)C#CCC1=CC(Cl)CCC1 |
| InChI | InChI=1S/C13H19Cl/c1-13(2,3)9-5-7-11-6-4-8-12(14)10-11/h10,12H,4,6-8H2,1-3H3 |
| InChIKey | KYLDQXBWXMZUJZ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.75 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene?
The IUPAC name of 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene (CID 130478932) is 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene.
What is the SMILES notation for 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene?
The canonical SMILES for 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene is CC(C)(C)C#CCC1=CC(Cl)CCC1.
What is the InChIKey of 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene?
The InChIKey is KYLDQXBWXMZUJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19Cl/c1-13(2,3)9-5-7-11-6-4-8-12(14)10-11/h10,12H,4,6-8H2,1-3H3.
What are the key properties of 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene?
3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene has a molecular weight of 210.75 g/mol, XLogP of 4.14, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-1-(4,4-dimethylpent-2-ynyl)cyclohexene is sourced from PubChem (CID 130478932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).