C11H18N2 — CID 130479233
1-(2-cyclopentylethyl)-5-methylpyrazole (PubChem CID 130479233) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-(2-cyclopentylethyl)-5-methylpyrazole.
| Compound Name | 1-(2-cyclopentylethyl)-5-methylpyrazole |
|---|---|
| PubChem CID | 130479233 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-(2-cyclopentylethyl)-5-methylpyrazole |
| SMILES | Cc1ccnn1CCC1CCCC1 |
| InChI | InChI=1S/C11H18N2/c1-10-6-8-12-13(10)9-7-11-4-2-3-5-11/h6,8,11H,2-5,7,9H2,1H3 |
| InChIKey | LERAJVLCYZWIAD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |