About dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate
dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate (PubChem CID 13048043) has the molecular formula C10H15NO5
and a molecular weight of 229.23 g/mol. Its IUPAC name is dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate |
| PubChem CID | 13048043 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate |
| SMILES | COC(=O)C1=CN(C)C(O)CC1C(=O)OC |
| InChI | InChI=1S/C10H15NO5/c1-11-5-7(10(14)16-3)6(4-8(11)12)9(13)15-2/h5-6,8,12H,4H2,1-3H3 |
| InChIKey | AOIGFKIOTCARGB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate?
The IUPAC name of dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate (CID 13048043) is dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate.
What is the SMILES notation for dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate?
The canonical SMILES for dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate is COC(=O)C1=CN(C)C(O)CC1C(=O)OC.
What is the InChIKey of dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate?
The InChIKey is AOIGFKIOTCARGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO5/c1-11-5-7(10(14)16-3)6(4-8(11)12)9(13)15-2/h5-6,8,12H,4H2,1-3H3.
What are the key properties of dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate?
dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate has a molecular weight of 229.23 g/mol, XLogP of -0.51, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-hydroxy-1-methyl-3,4-dihydro-2H-pyridine-4,5-dicarboxylate is sourced from PubChem (CID 13048043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).