C11H13ClF2 — CID 130480611
1-(1-chlorobutyl)-2,3-difluoro-4-methylbenzene (PubChem CID 130480611) has the molecular formula C11H13ClF2 and a molecular weight of 218.67 g/mol. Its IUPAC name is 1-(1-chlorobutyl)-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-(1-chlorobutyl)-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 130480611 |
| Molecular Formula | C11H13ClF2 |
| Molecular Weight | 218.67 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1-(1-chlorobutyl)-2,3-difluoro-4-methylbenzene |
| SMILES | CCCC(Cl)c1ccc(C)c(F)c1F |
| InChI | InChI=1S/C11H13ClF2/c1-3-4-9(12)8-6-5-7(2)10(13)11(8)14/h5-6,9H,3-4H2,1-2H3 |
| InChIKey | QXXURBDUDGLNAL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.67 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|