C11H13FO2 — CID 130480899
[1-(2-fluoro-5-methylphenoxy)cyclopropyl]methanol (PubChem CID 130480899) has the molecular formula C11H13FO2 and a molecular weight of 196.22 g/mol. Its IUPAC name is [1-(2-fluoro-5-methylphenoxy)cyclopropyl]methanol.
| Compound Name | [1-(2-fluoro-5-methylphenoxy)cyclopropyl]methanol |
|---|---|
| PubChem CID | 130480899 |
| Molecular Formula | C11H13FO2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | [1-(2-fluoro-5-methylphenoxy)cyclopropyl]methanol |
| SMILES | Cc1ccc(F)c(OC2(CO)CC2)c1 |
| InChI | InChI=1S/C11H13FO2/c1-8-2-3-9(12)10(6-8)14-11(7-13)4-5-11/h2-3,6,13H,4-5,7H2,1H3 |
| InChIKey | LCHLYOMXHMQCLT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |