C8H8ClN5 — CID 130484776
5-(chloromethyl)-2-methyl-4-(1,2,4-triazol-1-yl)pyrimidine (PubChem CID 130484776) has the molecular formula C8H8ClN5 and a molecular weight of 209.64 g/mol. Its IUPAC name is 5-(chloromethyl)-2-methyl-4-(1,2,4-triazol-1-yl)pyrimidine.
| Compound Name | 5-(chloromethyl)-2-methyl-4-(1,2,4-triazol-1-yl)pyrimidine |
|---|---|
| PubChem CID | 130484776 |
| Molecular Formula | C8H8ClN5 |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 5-(chloromethyl)-2-methyl-4-(1,2,4-triazol-1-yl)pyrimidine |
| SMILES | Cc1ncc(CCl)c(-n2cncn2)n1 |
| InChI | InChI=1S/C8H8ClN5/c1-6-11-3-7(2-9)8(13-6)14-5-10-4-12-14/h3-5H,2H2,1H3 |
| InChIKey | KOCYEXDVQDPSJF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|