About 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one
4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one (PubChem CID 130485298) has the molecular formula C8H8N4O2
and a molecular weight of 192.18 g/mol. Its IUPAC name is 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one |
| PubChem CID | 130485298 |
| Molecular Formula | C8H8N4O2 |
| Molecular Weight | 192.18 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one |
| SMILES | Cc1ccn(Cc2ncon2)c(=O)n1 |
| InChI | InChI=1S/C8H8N4O2/c1-6-2-3-12(8(13)10-6)4-7-9-5-14-11-7/h2-3,5H,4H2,1H3 |
| InChIKey | CYWWOOGCUPUACQ-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 73.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.18 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one?
The IUPAC name of 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one (CID 130485298) is 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one.
What is the SMILES notation for 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one?
The canonical SMILES for 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one is Cc1ccn(Cc2ncon2)c(=O)n1.
What is the InChIKey of 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one?
The InChIKey is CYWWOOGCUPUACQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N4O2/c1-6-2-3-12(8(13)10-6)4-7-9-5-14-11-7/h2-3,5H,4H2,1H3.
What are the key properties of 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one?
4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one has a molecular weight of 192.18 g/mol, XLogP of -0.02, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-(1,2,4-oxadiazol-3-ylmethyl)pyrimidin-2-one is sourced from PubChem (CID 130485298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).