About 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane
4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane (PubChem CID 130487520) has the molecular formula C11H17ClF2O
and a molecular weight of 238.70 g/mol. Its IUPAC name is 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane.
Molecular Properties
| Compound Name | 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane |
| PubChem CID | 130487520 |
| Molecular Formula | C11H17ClF2O |
| Molecular Weight | 238.70 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane |
| SMILES | FC1(F)CCC(CC2COCCC2Cl)C1 |
| InChI | InChI=1S/C11H17ClF2O/c12-10-2-4-15-7-9(10)5-8-1-3-11(13,14)6-8/h8-10H,1-7H2 |
| InChIKey | NJPCGIYKDNITQQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.70 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane?
The IUPAC name of 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane (CID 130487520) is 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane.
What is the SMILES notation for 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane?
The canonical SMILES for 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane is FC1(F)CCC(CC2COCCC2Cl)C1.
What is the InChIKey of 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane?
The InChIKey is NJPCGIYKDNITQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClF2O/c12-10-2-4-15-7-9(10)5-8-1-3-11(13,14)6-8/h8-10H,1-7H2.
What are the key properties of 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane?
4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane has a molecular weight of 238.70 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-[(3,3-difluorocyclopentyl)methyl]oxane is sourced from PubChem (CID 130487520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).