C9H11ClF2N2O — CID 130487723
2-(2-chloroethyl)-5-(3,3-difluorocyclopentyl)-1,3,4-oxadiazole (PubChem CID 130487723) has the molecular formula C9H11ClF2N2O and a molecular weight of 236.65 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5-(3,3-difluorocyclopentyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-chloroethyl)-5-(3,3-difluorocyclopentyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 130487723 |
| Molecular Formula | C9H11ClF2N2O |
| Molecular Weight | 236.65 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 2-(2-chloroethyl)-5-(3,3-difluorocyclopentyl)-1,3,4-oxadiazole |
| SMILES | FC1(F)CCC(c2nnc(CCCl)o2)C1 |
| InChI | InChI=1S/C9H11ClF2N2O/c10-4-2-7-13-14-8(15-7)6-1-3-9(11,12)5-6/h6H,1-5H2 |
| InChIKey | RGPBLXKZGGJAIE-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.65 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|