About [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol
[2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol (PubChem CID 130488853) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol.
Molecular Properties
| Compound Name | [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol |
| PubChem CID | 130488853 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol |
| SMILES | Cc1cccc(C2C(CO)C2(C)C)c1 |
| InChI | InChI=1S/C13H18O/c1-9-5-4-6-10(7-9)12-11(8-14)13(12,2)3/h4-7,11-12,14H,8H2,1-3H3 |
| InChIKey | MQEHRVVZBMRCPQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol?
The IUPAC name of [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol (CID 130488853) is [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol.
What is the SMILES notation for [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol?
The canonical SMILES for [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol is Cc1cccc(C2C(CO)C2(C)C)c1.
What is the InChIKey of [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol?
The InChIKey is MQEHRVVZBMRCPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-9-5-4-6-10(7-9)12-11(8-14)13(12,2)3/h4-7,11-12,14H,8H2,1-3H3.
What are the key properties of [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol?
[2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol has a molecular weight of 190.29 g/mol, XLogP of 2.73, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-dimethyl-3-(3-methylphenyl)cyclopropyl]methanol is sourced from PubChem (CID 130488853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).