C8H14FNO4S — CID 130490645
2-fluoro-2-(1-methylsulfonylpiperidin-4-yl)acetic acid (PubChem CID 130490645) has the molecular formula C8H14FNO4S and a molecular weight of 239.27 g/mol. Its IUPAC name is 2-fluoro-2-(1-methylsulfonylpiperidin-4-yl)acetic acid.
| Compound Name | 2-fluoro-2-(1-methylsulfonylpiperidin-4-yl)acetic acid |
|---|---|
| PubChem CID | 130490645 |
| Molecular Formula | C8H14FNO4S |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-fluoro-2-(1-methylsulfonylpiperidin-4-yl)acetic acid |
| SMILES | CS(=O)(=O)N1CCC(C(F)C(=O)O)CC1 |
| InChI | InChI=1S/C8H14FNO4S/c1-15(13,14)10-4-2-6(3-5-10)7(9)8(11)12/h6-7H,2-5H2,1H3,(H,11,12) |
| InChIKey | MCBHWFUQQTWLGJ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |