2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid

C11H19NO2 — CID 130492263

IUPAC2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid
SMILESC=CC(C(=O)O)N1CCCC(C)C1C
InChIInChI=1S/C11H19NO2/c1-4-10(11(13)14)12-7-5-6-8(2)9(12)3/h4,8-10H,1,5-7H2,2-3H3,(H,13,14)
InChIKeyYLMJSHGFCQSFGF-UHFFFAOYSA-N
MW197.28 g/mol
LogP1.75
Rot. Bonds3

About 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid

2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid (PubChem CID 130492263) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid.

Molecular Properties

Compound Name2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid
PubChem CID130492263
Molecular FormulaC11H19NO2
Molecular Weight197.28 g/mol
Exact Mass197.14
IUPAC Name2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid
SMILESC=CC(C(=O)O)N1CCCC(C)C1C
InChIInChI=1S/C11H19NO2/c1-4-10(11(13)14)12-7-5-6-8(2)9(12)3/h4,8-10H,1,5-7H2,2-3H3,(H,13,14)
InChIKeyYLMJSHGFCQSFGF-UHFFFAOYSA-N
XLogP1.75
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.28
LogP ≤ 51.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid?
The IUPAC name of 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid (CID 130492263) is 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid.
What is the SMILES notation for 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid?
The canonical SMILES for 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid is C=CC(C(=O)O)N1CCCC(C)C1C.
What is the InChIKey of 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid?
The InChIKey is YLMJSHGFCQSFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-4-10(11(13)14)12-7-5-6-8(2)9(12)3/h4,8-10H,1,5-7H2,2-3H3,(H,13,14).
What are the key properties of 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid?
2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid has a molecular weight of 197.28 g/mol, XLogP of 1.75, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid is sourced from PubChem (CID 130492263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).