C11H19NO2 — CID 130492263
2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid (PubChem CID 130492263) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid.
| Compound Name | 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid |
|---|---|
| PubChem CID | 130492263 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 2-(2,3-dimethylpiperidin-1-yl)but-3-enoic acid |
| SMILES | C=CC(C(=O)O)N1CCCC(C)C1C |
| InChI | InChI=1S/C11H19NO2/c1-4-10(11(13)14)12-7-5-6-8(2)9(12)3/h4,8-10H,1,5-7H2,2-3H3,(H,13,14) |
| InChIKey | YLMJSHGFCQSFGF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|