C10H17NO2S2 — CID 13049300
(2R,3S)-3-hydroxy-2,4-dimethyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)pentan-1-one (PubChem CID 13049300) has the molecular formula C10H17NO2S2 and a molecular weight of 247.38 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2,4-dimethyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)pentan-1-one.
| Compound Name | (2R,3S)-3-hydroxy-2,4-dimethyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 13049300 |
| Molecular Formula | C10H17NO2S2 |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | (2R,3S)-3-hydroxy-2,4-dimethyl-1-(2-sulfanylidene-1,3-thiazolidin-3-yl)pentan-1-one |
| SMILES | CC(C)[C@H](O)[C@@H](C)C(=O)N1CCSC1=S |
| InChI | InChI=1S/C10H17NO2S2/c1-6(2)8(12)7(3)9(13)11-4-5-15-10(11)14/h6-8,12H,4-5H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | GNJMXKRVJLBFOC-SFYZADRCSA-N |
| XLogP | 1.50 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|