About 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole
3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole (PubChem CID 130493015) has the molecular formula C7H11N3O
and a molecular weight of 153.18 g/mol. Its IUPAC name is 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole.
Molecular Properties
| Compound Name | 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole |
| PubChem CID | 130493015 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole |
| SMILES | Cc1nc(C)n(C[C@@H]2CO2)n1 |
| InChI | InChI=1S/C7H11N3O/c1-5-8-6(2)10(9-5)3-7-4-11-7/h7H,3-4H2,1-2H3/t7-/m1/s1 |
| InChIKey | YNPUSKKCWGJURS-SSDOTTSWSA-N |
| XLogP | 0.29 |
| TPSA | 43.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole?
The IUPAC name of 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole (CID 130493015) is 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole.
What is the SMILES notation for 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole?
The canonical SMILES for 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole is Cc1nc(C)n(C[C@@H]2CO2)n1.
What is the InChIKey of 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole?
The InChIKey is YNPUSKKCWGJURS-SSDOTTSWSA-N. The full InChI is InChI=1S/C7H11N3O/c1-5-8-6(2)10(9-5)3-7-4-11-7/h7H,3-4H2,1-2H3/t7-/m1/s1.
What are the key properties of 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole?
3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole has a molecular weight of 153.18 g/mol, XLogP of 0.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]-1,2,4-triazole is sourced from PubChem (CID 130493015), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).