C8H11NO2S — CID 130493070
4,5-dimethyl-3-[[(2S)-oxiran-2-yl]methyl]-1,3-thiazol-2-one (PubChem CID 130493070) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 4,5-dimethyl-3-[[(2S)-oxiran-2-yl]methyl]-1,3-thiazol-2-one.
| Compound Name | 4,5-dimethyl-3-[[(2S)-oxiran-2-yl]methyl]-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 130493070 |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 4,5-dimethyl-3-[[(2S)-oxiran-2-yl]methyl]-1,3-thiazol-2-one |
| SMILES | Cc1sc(=O)n(C[C@H]2CO2)c1C |
| InChI | InChI=1S/C8H11NO2S/c1-5-6(2)12-8(10)9(5)3-7-4-11-7/h7H,3-4H2,1-2H3/t7-/m0/s1 |
| InChIKey | RDLUFOUCMIMPNI-ZETCQYMHSA-N |
| XLogP | 0.93 |
| TPSA | 34.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|