C14H28O2Si2 — CID 13049316
trimethyl-[(1R,2Z,6Z,8R)-8-trimethylsilyloxycycloocta-2,6-dien-1-yl]oxysilane (PubChem CID 13049316) has the molecular formula C14H28O2Si2 and a molecular weight of 284.55 g/mol. Its IUPAC name is trimethyl-[(1R,2Z,6Z,8R)-8-trimethylsilyloxycycloocta-2,6-dien-1-yl]oxysilane.
| Compound Name | trimethyl-[(1R,2Z,6Z,8R)-8-trimethylsilyloxycycloocta-2,6-dien-1-yl]oxysilane |
|---|---|
| PubChem CID | 13049316 |
| Molecular Formula | C14H28O2Si2 |
| Molecular Weight | 284.55 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | trimethyl-[(1R,2Z,6Z,8R)-8-trimethylsilyloxycycloocta-2,6-dien-1-yl]oxysilane |
| SMILES | C[Si](C)(C)O[C@@H]1/C=C\CC/C=C\[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C14H28O2Si2/c1-17(2,3)15-13-11-9-7-8-10-12-14(13)16-18(4,5)6/h9-14H,7-8H2,1-6H3/b11-9-,12-10-/t13-,14-/m1/s1 |
| InChIKey | LXZCPELOWDXLJK-WQOGQPEPSA-N |
| XLogP | 4.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.55 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|