About (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol
(2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol (PubChem CID 130493422) has the molecular formula C6H10N2O2S
and a molecular weight of 174.23 g/mol. Its IUPAC name is (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol.
Molecular Properties
| Compound Name | (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol |
| PubChem CID | 130493422 |
| Molecular Formula | C6H10N2O2S |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol |
| SMILES | NC[C@@H](O)CSc1ncco1 |
| InChI | InChI=1S/C6H10N2O2S/c7-3-5(9)4-11-6-8-1-2-10-6/h1-2,5,9H,3-4,7H2/t5-/m1/s1 |
| InChIKey | FKKHKYVPTBGQRE-RXMQYKEDSA-N |
| XLogP | 0.09 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol?
The IUPAC name of (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol (CID 130493422) is (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol.
What is the SMILES notation for (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol?
The canonical SMILES for (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol is NC[C@@H](O)CSc1ncco1.
What is the InChIKey of (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol?
The InChIKey is FKKHKYVPTBGQRE-RXMQYKEDSA-N. The full InChI is InChI=1S/C6H10N2O2S/c7-3-5(9)4-11-6-8-1-2-10-6/h1-2,5,9H,3-4,7H2/t5-/m1/s1.
What are the key properties of (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol?
(2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol has a molecular weight of 174.23 g/mol, XLogP of 0.09, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-amino-3-(1,3-oxazol-2-ylsulfanyl)propan-2-ol is sourced from PubChem (CID 130493422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).