About 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal
3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal (PubChem CID 130494982) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal.
Molecular Properties
| Compound Name | 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal |
| PubChem CID | 130494982 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal |
| SMILES | O=CCCN1CC2CC3CC2C1C3O |
| InChI | InChI=1S/C11H17NO2/c13-3-1-2-12-6-8-4-7-5-9(8)10(12)11(7)14/h3,7-11,14H,1-2,4-6H2 |
| InChIKey | WANABTWHBRSLSX-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal?
The IUPAC name of 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal (CID 130494982) is 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal.
What is the SMILES notation for 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal?
The canonical SMILES for 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal is O=CCCN1CC2CC3CC2C1C3O.
What is the InChIKey of 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal?
The InChIKey is WANABTWHBRSLSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO2/c13-3-1-2-12-6-8-4-7-5-9(8)10(12)11(7)14/h3,7-11,14H,1-2,4-6H2.
What are the key properties of 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal?
3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal has a molecular weight of 195.26 g/mol, XLogP of 0.28, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)propanal is sourced from PubChem (CID 130494982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).