About 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one
4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one (PubChem CID 130494985) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one.
Molecular Properties
| Compound Name | 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one |
| PubChem CID | 130494985 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one |
| SMILES | CC(=O)CCN1CC2CC3CC2C1C3O |
| InChI | InChI=1S/C12H19NO2/c1-7(14)2-3-13-6-9-4-8-5-10(9)11(13)12(8)15/h8-12,15H,2-6H2,1H3 |
| InChIKey | VFJXMLSFNOPNHY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one?
The IUPAC name of 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one (CID 130494985) is 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one.
What is the SMILES notation for 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one?
The canonical SMILES for 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one is CC(=O)CCN1CC2CC3CC2C1C3O.
What is the InChIKey of 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one?
The InChIKey is VFJXMLSFNOPNHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-7(14)2-3-13-6-9-4-8-5-10(9)11(13)12(8)15/h8-12,15H,2-6H2,1H3.
What are the key properties of 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one?
4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one has a molecular weight of 209.29 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxy-4-azatricyclo[4.2.1.03,7]nonan-4-yl)butan-2-one is sourced from PubChem (CID 130494985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).