About dimethyl 2-heptanoylbutanedioate
dimethyl 2-heptanoylbutanedioate (PubChem CID 13049532) has the molecular formula C13H22O5
and a molecular weight of 258.31 g/mol. Its IUPAC name is dimethyl 2-heptanoylbutanedioate.
Molecular Properties
| Compound Name | dimethyl 2-heptanoylbutanedioate |
| PubChem CID | 13049532 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | dimethyl 2-heptanoylbutanedioate |
| SMILES | CCCCCCC(=O)C(CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H22O5/c1-4-5-6-7-8-11(14)10(13(16)18-3)9-12(15)17-2/h10H,4-9H2,1-3H3 |
| InChIKey | LZWKSJUSGVSIMY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 2-heptanoylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 2-heptanoylbutanedioate?
The IUPAC name of dimethyl 2-heptanoylbutanedioate (CID 13049532) is dimethyl 2-heptanoylbutanedioate.
What is the SMILES notation for dimethyl 2-heptanoylbutanedioate?
The canonical SMILES for dimethyl 2-heptanoylbutanedioate is CCCCCCC(=O)C(CC(=O)OC)C(=O)OC.
What is the InChIKey of dimethyl 2-heptanoylbutanedioate?
The InChIKey is LZWKSJUSGVSIMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22O5/c1-4-5-6-7-8-11(14)10(13(16)18-3)9-12(15)17-2/h10H,4-9H2,1-3H3.
What are the key properties of dimethyl 2-heptanoylbutanedioate?
dimethyl 2-heptanoylbutanedioate has a molecular weight of 258.31 g/mol, XLogP of 1.88, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 2-heptanoylbutanedioate is sourced from PubChem (CID 13049532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).