C12H20Si — CID 13049558
2,3,7,8-tetramethyl-5-silaspiro[4.4]nona-2,7-diene (PubChem CID 13049558) has the molecular formula C12H20Si and a molecular weight of 192.38 g/mol. Its IUPAC name is 2,3,7,8-tetramethyl-5-silaspiro[4.4]nona-2,7-diene.
| Compound Name | 2,3,7,8-tetramethyl-5-silaspiro[4.4]nona-2,7-diene |
|---|---|
| PubChem CID | 13049558 |
| Molecular Formula | C12H20Si |
| Molecular Weight | 192.38 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2,3,7,8-tetramethyl-5-silaspiro[4.4]nona-2,7-diene |
| SMILES | CC1=C(C)C[Si]2(C1)CC(C)=C(C)C2 |
| InChI | InChI=1S/C12H20Si/c1-9-5-13(6-10(9)2)7-11(3)12(4)8-13/h5-8H2,1-4H3 |
| InChIKey | QYODCCHISKIBDA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.38 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|