About (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene
(4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene (PubChem CID 13049640) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene.
Molecular Properties
| Compound Name | (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene |
| PubChem CID | 13049640 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene |
| SMILES | C1=C\CCC2OC2CC/C=C/CC/1 |
| InChI | InChI=1S/C12H18O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h3-6,11-12H,1-2,7-10H2/b5-3-,6-4+ |
| InChIKey | OWUVDWLTQIPNLN-CIIODKQPSA-N |
| XLogP | 3.22 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene?
The IUPAC name of (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene (CID 13049640) is (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene.
What is the SMILES notation for (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene?
The canonical SMILES for (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene is C1=C\CCC2OC2CC/C=C/CC/1.
What is the InChIKey of (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene?
The InChIKey is OWUVDWLTQIPNLN-CIIODKQPSA-N. The full InChI is InChI=1S/C12H18O/c1-2-4-6-8-10-12-11(13-12)9-7-5-3-1/h3-6,11-12H,1-2,7-10H2/b5-3-,6-4+.
What are the key properties of (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene?
(4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene has a molecular weight of 178.27 g/mol, XLogP of 3.22, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z,8E)-13-oxabicyclo[10.1.0]trideca-4,8-diene is sourced from PubChem (CID 13049640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).