C9H13N5 — CID 130497130
1-(1,5-dimethylpyrazol-3-yl)-5-methylpyrazol-3-amine (PubChem CID 130497130) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is 1-(1,5-dimethylpyrazol-3-yl)-5-methylpyrazol-3-amine.
| Compound Name | 1-(1,5-dimethylpyrazol-3-yl)-5-methylpyrazol-3-amine |
|---|---|
| PubChem CID | 130497130 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 1-(1,5-dimethylpyrazol-3-yl)-5-methylpyrazol-3-amine |
| SMILES | Cc1cc(-n2nc(N)cc2C)nn1C |
| InChI | InChI=1S/C9H13N5/c1-6-5-9(12-13(6)3)14-7(2)4-8(10)11-14/h4-5H,1-3H3,(H2,10,11) |
| InChIKey | NQTAFHMGMPOIOY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |