C10H8ClNOS2 — CID 130501364
2-[(2-chlorophenyl)sulfanylmethyl]-1,3-thiazol-4-ol (PubChem CID 130501364) has the molecular formula C10H8ClNOS2 and a molecular weight of 257.77 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)sulfanylmethyl]-1,3-thiazol-4-ol.
| Compound Name | 2-[(2-chlorophenyl)sulfanylmethyl]-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 130501364 |
| Molecular Formula | C10H8ClNOS2 |
| Molecular Weight | 257.77 g/mol |
| Exact Mass | 256.97 |
| IUPAC Name | 2-[(2-chlorophenyl)sulfanylmethyl]-1,3-thiazol-4-ol |
| SMILES | Oc1csc(CSc2ccccc2Cl)n1 |
| InChI | InChI=1S/C10H8ClNOS2/c11-7-3-1-2-4-8(7)14-6-10-12-9(13)5-15-10/h1-5,13H,6H2 |
| InChIKey | QOSBFBQCZZJOTO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.77 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |