About 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol
2-(4-propylcyclohexyl)-1,3-thiazol-4-ol (PubChem CID 130501522) has the molecular formula C12H19NOS
and a molecular weight of 225.36 g/mol. Its IUPAC name is 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol.
Molecular Properties
| Compound Name | 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol |
| PubChem CID | 130501522 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol |
| SMILES | CCCC1CCC(c2nc(O)cs2)CC1 |
| InChI | InChI=1S/C12H19NOS/c1-2-3-9-4-6-10(7-5-9)12-13-11(14)8-15-12/h8-10,14H,2-7H2,1H3 |
| InChIKey | YLFYQWFQEWROAA-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol?
The IUPAC name of 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol (CID 130501522) is 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol.
What is the SMILES notation for 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol?
The canonical SMILES for 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol is CCCC1CCC(c2nc(O)cs2)CC1.
What is the InChIKey of 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol?
The InChIKey is YLFYQWFQEWROAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NOS/c1-2-3-9-4-6-10(7-5-9)12-13-11(14)8-15-12/h8-10,14H,2-7H2,1H3.
What are the key properties of 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol?
2-(4-propylcyclohexyl)-1,3-thiazol-4-ol has a molecular weight of 225.36 g/mol, XLogP of 3.92, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-propylcyclohexyl)-1,3-thiazol-4-ol is sourced from PubChem (CID 130501522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).