C22H14O12S2 — CID 13050202
4-[4-(3,4-dicarboxyphenyl)sulfonylphenyl]sulfonylphthalic acid (PubChem CID 13050202) has the molecular formula C22H14O12S2 and a molecular weight of 534.48 g/mol. Its IUPAC name is 4-[4-(3,4-dicarboxyphenyl)sulfonylphenyl]sulfonylphthalic acid.
| Compound Name | 4-[4-(3,4-dicarboxyphenyl)sulfonylphenyl]sulfonylphthalic acid |
|---|---|
| PubChem CID | 13050202 |
| Molecular Formula | C22H14O12S2 |
| Molecular Weight | 534.48 g/mol |
| Exact Mass | 533.99 |
| IUPAC Name | 4-[4-(3,4-dicarboxyphenyl)sulfonylphenyl]sulfonylphthalic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)c2ccc(S(=O)(=O)c3ccc(C(=O)O)c(C(=O)O)c3)cc2)cc1C(=O)O |
| InChI | InChI=1S/C22H14O12S2/c23-19(24)15-7-5-13(9-17(15)21(27)28)35(31,32)11-1-2-12(4-3-11)36(33,34)14-6-8-16(20(25)26)18(10-14)22(29)30/h1-10H,(H,23,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | LGKAYURQFYWDHW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 217.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.48 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |