About 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine
2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine (PubChem CID 130503579) has the molecular formula C11H21NOS
and a molecular weight of 215.36 g/mol. Its IUPAC name is 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine.
Molecular Properties
| Compound Name | 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine |
| PubChem CID | 130503579 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine |
| SMILES | CCC1(C2CCOC2)NC(C)(C)CS1 |
| InChI | InChI=1S/C11H21NOS/c1-4-11(9-5-6-13-7-9)12-10(2,3)8-14-11/h9,12H,4-8H2,1-3H3 |
| InChIKey | HJZYFJGQOGTPIL-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine?
The IUPAC name of 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine (CID 130503579) is 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine.
What is the SMILES notation for 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine?
The canonical SMILES for 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine is CCC1(C2CCOC2)NC(C)(C)CS1.
What is the InChIKey of 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine?
The InChIKey is HJZYFJGQOGTPIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NOS/c1-4-11(9-5-6-13-7-9)12-10(2,3)8-14-11/h9,12H,4-8H2,1-3H3.
What are the key properties of 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine?
2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine has a molecular weight of 215.36 g/mol, XLogP of 2.24, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4,4-dimethyl-2-(oxolan-3-yl)-1,3-thiazolidine is sourced from PubChem (CID 130503579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).