4-amino-5,5-difluoropentanoic acid

C5H9F2NO2 — CID 13050369

IUPAC4-amino-5,5-difluoropentanoic acid
SMILESNC(CCC(=O)O)C(F)F
InChIInChI=1S/C5H9F2NO2/c6-5(7)3(8)1-2-4(9)10/h3,5H,1-2,8H2,(H,9,10)
InChIKeyOONKUSOSFMPOHE-UHFFFAOYSA-N
MW153.13 g/mol
LogP0.44
Rot. Bonds4

About 4-amino-5,5-difluoropentanoic acid

4-amino-5,5-difluoropentanoic acid (PubChem CID 13050369) has the molecular formula C5H9F2NO2 and a molecular weight of 153.13 g/mol. Its IUPAC name is 4-amino-5,5-difluoropentanoic acid.

Molecular Properties

Compound Name4-amino-5,5-difluoropentanoic acid
PubChem CID13050369
Molecular FormulaC5H9F2NO2
Molecular Weight153.13 g/mol
Exact Mass153.06
IUPAC Name4-amino-5,5-difluoropentanoic acid
SMILESNC(CCC(=O)O)C(F)F
InChIInChI=1S/C5H9F2NO2/c6-5(7)3(8)1-2-4(9)10/h3,5H,1-2,8H2,(H,9,10)
InChIKeyOONKUSOSFMPOHE-UHFFFAOYSA-N
XLogP0.44
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500153.13
LogP ≤ 50.44
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-amino-5,5-difluoropentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-Aminobutyric Acid
CID 223130
4-Aminovaleric acid, (R)-
CID 444458
(4S)-4-Aminopentanoic acid
CID 5312968
5-Fluoronorvaline
CID 101662
5,5,5-Trifluoro-DL-norvaline
CID 253377
4-Amino-5-fluoropentanoic acid
CID 130363
2-(Perfluoropropyl)glycine
CID 21295225
3-(Aminomethyl)-4,4,5,5-tetrafluoropentanoic acid
CID 122181807
(4S,5R)-4-amino-5-fluorohexanoic acid
CID 71524820
(4S,5S)-4-amino-5-fluorohexanoic acid
CID 71524821
(4R,5R)-4-amino-5-fluorohexanoic acid
CID 71524822
(S)-2-Amino-5,5,5-trifluoropentanoic acid
CID 7177179

Frequently Asked Questions

What is the IUPAC name of 4-amino-5,5-difluoropentanoic acid?
The IUPAC name of 4-amino-5,5-difluoropentanoic acid (CID 13050369) is 4-amino-5,5-difluoropentanoic acid.
What is the SMILES notation for 4-amino-5,5-difluoropentanoic acid?
The canonical SMILES for 4-amino-5,5-difluoropentanoic acid is NC(CCC(=O)O)C(F)F.
What is the InChIKey of 4-amino-5,5-difluoropentanoic acid?
The InChIKey is OONKUSOSFMPOHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9F2NO2/c6-5(7)3(8)1-2-4(9)10/h3,5H,1-2,8H2,(H,9,10).
What are the key properties of 4-amino-5,5-difluoropentanoic acid?
4-amino-5,5-difluoropentanoic acid has a molecular weight of 153.13 g/mol, XLogP of 0.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-5,5-difluoropentanoic acid is sourced from PubChem (CID 13050369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).