About N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine
N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine (PubChem CID 130503964) has the molecular formula C10H18FNO2
and a molecular weight of 203.26 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine.
Molecular Properties
| Compound Name | N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine |
| PubChem CID | 130503964 |
| Molecular Formula | C10H18FNO2 |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine |
| SMILES | FCCNC1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C10H18FNO2/c11-3-4-12-9-1-5-14-10(7-9)2-6-13-8-10/h9,12H,1-8H2 |
| InChIKey | LAXOFHAHYOETFP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine?
The IUPAC name of N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine (CID 130503964) is N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine.
What is the SMILES notation for N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine?
The canonical SMILES for N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine is FCCNC1CCOC2(CCOC2)C1.
What is the InChIKey of N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine?
The InChIKey is LAXOFHAHYOETFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18FNO2/c11-3-4-12-9-1-5-14-10(7-9)2-6-13-8-10/h9,12H,1-8H2.
What are the key properties of N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine?
N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine has a molecular weight of 203.26 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoroethyl)-2,6-dioxaspiro[4.5]decan-9-amine is sourced from PubChem (CID 130503964), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).