C9H17FN2O — CID 130504072
2-amino-N-(2-fluoroethyl)cyclohexane-1-carboxamide (PubChem CID 130504072) has the molecular formula C9H17FN2O and a molecular weight of 188.25 g/mol. Its IUPAC name is 2-amino-N-(2-fluoroethyl)cyclohexane-1-carboxamide.
| Compound Name | 2-amino-N-(2-fluoroethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 130504072 |
| Molecular Formula | C9H17FN2O |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-amino-N-(2-fluoroethyl)cyclohexane-1-carboxamide |
| SMILES | NC1CCCCC1C(=O)NCCF |
| InChI | InChI=1S/C9H17FN2O/c10-5-6-12-9(13)7-3-1-2-4-8(7)11/h7-8H,1-6,11H2,(H,12,13) |
| InChIKey | STRVMIKGPGRRGC-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |