C8H13FN4 — CID 130504306
N-(3-fluoropropyl)-5,6-dimethyl-1,2,4-triazin-3-amine (PubChem CID 130504306) has the molecular formula C8H13FN4 and a molecular weight of 184.22 g/mol. Its IUPAC name is N-(3-fluoropropyl)-5,6-dimethyl-1,2,4-triazin-3-amine.
| Compound Name | N-(3-fluoropropyl)-5,6-dimethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 130504306 |
| Molecular Formula | C8H13FN4 |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.11 |
| IUPAC Name | N-(3-fluoropropyl)-5,6-dimethyl-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(NCCCF)nc1C |
| InChI | InChI=1S/C8H13FN4/c1-6-7(2)12-13-8(11-6)10-5-3-4-9/h3-5H2,1-2H3,(H,10,11,13) |
| InChIKey | NXPOCQPDBRWPGY-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|