C28H38O4S2 — CID 13050540
methyl 5-[4-[4-(5-methoxy-4,4-dimethyl-5-oxopentyl)sulfanylphenyl]phenyl]sulfanyl-2,2-dimethylpentanoate (PubChem CID 13050540) has the molecular formula C28H38O4S2 and a molecular weight of 502.74 g/mol. Its IUPAC name is methyl 5-[4-[4-(5-methoxy-4,4-dimethyl-5-oxopentyl)sulfanylphenyl]phenyl]sulfanyl-2,2-dimethylpentanoate.
| Compound Name | methyl 5-[4-[4-(5-methoxy-4,4-dimethyl-5-oxopentyl)sulfanylphenyl]phenyl]sulfanyl-2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 13050540 |
| Molecular Formula | C28H38O4S2 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | methyl 5-[4-[4-(5-methoxy-4,4-dimethyl-5-oxopentyl)sulfanylphenyl]phenyl]sulfanyl-2,2-dimethylpentanoate |
| SMILES | COC(=O)C(C)(C)CCCSc1ccc(-c2ccc(SCCCC(C)(C)C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C28H38O4S2/c1-27(2,25(29)31-5)17-7-19-33-23-13-9-21(10-14-23)22-11-15-24(16-12-22)34-20-8-18-28(3,4)26(30)32-6/h9-16H,7-8,17-20H2,1-6H3 |
| InChIKey | FYOUBFAKLRFODN-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|