C8H13N3S2 — CID 130506255
N-[(1-methylsulfanylcyclobutyl)methyl]thiadiazol-5-amine (PubChem CID 130506255) has the molecular formula C8H13N3S2 and a molecular weight of 215.35 g/mol. Its IUPAC name is N-[(1-methylsulfanylcyclobutyl)methyl]thiadiazol-5-amine.
| Compound Name | N-[(1-methylsulfanylcyclobutyl)methyl]thiadiazol-5-amine |
|---|---|
| PubChem CID | 130506255 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | N-[(1-methylsulfanylcyclobutyl)methyl]thiadiazol-5-amine |
| SMILES | CSC1(CNc2cnns2)CCC1 |
| InChI | InChI=1S/C8H13N3S2/c1-12-8(3-2-4-8)6-9-7-5-10-11-13-7/h5,9H,2-4,6H2,1H3 |
| InChIKey | RTCGNQBXGHIXOH-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |