About spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride
spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride (PubChem CID 13050640) has the molecular formula C12H15ClN2O2
and a molecular weight of 254.72 g/mol. Its IUPAC name is spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride.
Molecular Properties
| Compound Name | spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride |
| PubChem CID | 13050640 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride |
| SMILES | Cl.O=C1Nc2ccccc2C2(CCNCC2)O1 |
| InChI | InChI=1S/C12H14N2O2.ClH/c15-11-14-10-4-2-1-3-9(10)12(16-11)5-7-13-8-6-12;/h1-4,13H,5-8H2,(H,14,15);1H |
| InChIKey | QNADLUDHFUAJIK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride?
The IUPAC name of spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride (CID 13050640) is spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride.
What is the SMILES notation for spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride?
The canonical SMILES for spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride is Cl.O=C1Nc2ccccc2C2(CCNCC2)O1.
What is the InChIKey of spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride?
The InChIKey is QNADLUDHFUAJIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2.ClH/c15-11-14-10-4-2-1-3-9(10)12(16-11)5-7-13-8-6-12;/h1-4,13H,5-8H2,(H,14,15);1H.
What are the key properties of spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride?
spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride has a molecular weight of 254.72 g/mol, XLogP of 2.25, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-3,1-benzoxazine-4,4'-piperidine]-2-one;hydrochloride is sourced from PubChem (CID 13050640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).