C9H11NO — CID 130506685
5-(furan-3-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 130506685) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 5-(furan-3-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-(furan-3-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 130506685 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 5-(furan-3-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C1=C(c2ccoc2)CNCC1 |
| InChI | InChI=1S/C9H11NO/c1-2-8(6-10-4-1)9-3-5-11-7-9/h2-3,5,7,10H,1,4,6H2 |
| InChIKey | MMWGZRKGNKQFEP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |