About N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine
N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine (PubChem CID 13050737) has the molecular formula C10H14N4O
and a molecular weight of 206.25 g/mol. Its IUPAC name is N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine |
| PubChem CID | 13050737 |
| Molecular Formula | C10H14N4O |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine |
| SMILES | CCN(CC)c1nc(C)nc2ocnc12 |
| InChI | InChI=1S/C10H14N4O/c1-4-14(5-2)9-8-10(15-6-11-8)13-7(3)12-9/h6H,4-5H2,1-3H3 |
| InChIKey | QOLAUGOKAMTGGV-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The IUPAC name of N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine (CID 13050737) is N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine.
What is the SMILES notation for N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The canonical SMILES for N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine is CCN(CC)c1nc(C)nc2ocnc12.
What is the InChIKey of N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The InChIKey is QOLAUGOKAMTGGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N4O/c1-4-14(5-2)9-8-10(15-6-11-8)13-7(3)12-9/h6H,4-5H2,1-3H3.
What are the key properties of N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine has a molecular weight of 206.25 g/mol, XLogP of 1.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-5-methyl-[1,3]oxazolo[5,4-d]pyrimidin-7-amine is sourced from PubChem (CID 13050737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).