C10H20F2N2 — CID 130507551
N-(2,2-difluoroethyl)-N,2,6-trimethylpiperidin-4-amine (PubChem CID 130507551) has the molecular formula C10H20F2N2 and a molecular weight of 206.28 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-N,2,6-trimethylpiperidin-4-amine.
| Compound Name | N-(2,2-difluoroethyl)-N,2,6-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 130507551 |
| Molecular Formula | C10H20F2N2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.16 |
| IUPAC Name | N-(2,2-difluoroethyl)-N,2,6-trimethylpiperidin-4-amine |
| SMILES | CC1CC(N(C)CC(F)F)CC(C)N1 |
| InChI | InChI=1S/C10H20F2N2/c1-7-4-9(5-8(2)13-7)14(3)6-10(11)12/h7-10,13H,4-6H2,1-3H3 |
| InChIKey | RGYFYBHLZCNOTO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |