About 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine
3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine (PubChem CID 130507657) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine.
Molecular Properties
| Compound Name | 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine |
| PubChem CID | 130507657 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine |
| SMILES | Cc1cc(C#CCN)cc(C)n1 |
| InChI | InChI=1S/C10H12N2/c1-8-6-10(4-3-5-11)7-9(2)12-8/h6-7H,5,11H2,1-2H3 |
| InChIKey | GUDMESMGKNBTGS-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine?
The IUPAC name of 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine (CID 130507657) is 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine.
What is the SMILES notation for 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine?
The canonical SMILES for 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine is Cc1cc(C#CCN)cc(C)n1.
What is the InChIKey of 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine?
The InChIKey is GUDMESMGKNBTGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-8-6-10(4-3-5-11)7-9(2)12-8/h6-7H,5,11H2,1-2H3.
What are the key properties of 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine?
3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine has a molecular weight of 160.22 g/mol, XLogP of 1.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethyl-4-pyridinyl)prop-2-yn-1-amine is sourced from PubChem (CID 130507657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).