About 1-(azetidin-3-yl)-4,5-diiodoimidazole
1-(azetidin-3-yl)-4,5-diiodoimidazole (PubChem CID 130508489) has the molecular formula C6H7I2N3
and a molecular weight of 374.95 g/mol. Its IUPAC name is 1-(azetidin-3-yl)-4,5-diiodoimidazole.
Molecular Properties
| Compound Name | 1-(azetidin-3-yl)-4,5-diiodoimidazole |
| PubChem CID | 130508489 |
| Molecular Formula | C6H7I2N3 |
| Molecular Weight | 374.95 g/mol |
| Exact Mass | 374.87 |
| IUPAC Name | 1-(azetidin-3-yl)-4,5-diiodoimidazole |
| SMILES | Ic1ncn(C2CNC2)c1I |
| InChI | InChI=1S/C6H7I2N3/c7-5-6(8)11(3-10-5)4-1-9-2-4/h3-4,9H,1-2H2 |
| InChIKey | ZFNFJVMNTBJPIB-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.95 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(azetidin-3-yl)-4,5-diiodoimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(azetidin-3-yl)-4,5-diiodoimidazole?
The IUPAC name of 1-(azetidin-3-yl)-4,5-diiodoimidazole (CID 130508489) is 1-(azetidin-3-yl)-4,5-diiodoimidazole.
What is the SMILES notation for 1-(azetidin-3-yl)-4,5-diiodoimidazole?
The canonical SMILES for 1-(azetidin-3-yl)-4,5-diiodoimidazole is Ic1ncn(C2CNC2)c1I.
What is the InChIKey of 1-(azetidin-3-yl)-4,5-diiodoimidazole?
The InChIKey is ZFNFJVMNTBJPIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7I2N3/c7-5-6(8)11(3-10-5)4-1-9-2-4/h3-4,9H,1-2H2.
What are the key properties of 1-(azetidin-3-yl)-4,5-diiodoimidazole?
1-(azetidin-3-yl)-4,5-diiodoimidazole has a molecular weight of 374.95 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(azetidin-3-yl)-4,5-diiodoimidazole is sourced from PubChem (CID 130508489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).