About 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone
1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone (PubChem CID 130508546) has the molecular formula C8H8I2N2O
and a molecular weight of 401.97 g/mol. Its IUPAC name is 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone |
| PubChem CID | 130508546 |
| Molecular Formula | C8H8I2N2O |
| Molecular Weight | 401.97 g/mol |
| Exact Mass | 401.87 |
| IUPAC Name | 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone |
| SMILES | O=C(Cn1cnc(I)c1I)C1CC1 |
| InChI | InChI=1S/C8H8I2N2O/c9-7-8(10)12(4-11-7)3-6(13)5-1-2-5/h4-5H,1-3H2 |
| InChIKey | WIDVAUJGQWVQNK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.97 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone?
The IUPAC name of 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone (CID 130508546) is 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone.
What is the SMILES notation for 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone?
The canonical SMILES for 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone is O=C(Cn1cnc(I)c1I)C1CC1.
What is the InChIKey of 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone?
The InChIKey is WIDVAUJGQWVQNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8I2N2O/c9-7-8(10)12(4-11-7)3-6(13)5-1-2-5/h4-5H,1-3H2.
What are the key properties of 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone?
1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone has a molecular weight of 401.97 g/mol, XLogP of 2.07, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-(4,5-diiodoimidazol-1-yl)ethanone is sourced from PubChem (CID 130508546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).