C11H18N2O — CID 130510201
3-(2,5-dihydro-1H-pyrrol-2-yl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 130510201) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-(2,5-dihydro-1H-pyrrol-2-yl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 3-(2,5-dihydro-1H-pyrrol-2-yl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 130510201 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 3-(2,5-dihydro-1H-pyrrol-2-yl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | OC1(C2C=CCN2)CC2CCC(C1)N2 |
| InChI | InChI=1S/C11H18N2O/c14-11(10-2-1-5-12-10)6-8-3-4-9(7-11)13-8/h1-2,8-10,12-14H,3-7H2 |
| InChIKey | YQINSBLFTAQJQY-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|