About (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine
(2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine (PubChem CID 130511719) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine.
Molecular Properties
| Compound Name | (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine |
| PubChem CID | 130511719 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine |
| SMILES | CCC(C)C1(C)OCC(CN)O1 |
| InChI | InChI=1S/C9H19NO2/c1-4-7(2)9(3)11-6-8(5-10)12-9/h7-8H,4-6,10H2,1-3H3 |
| InChIKey | PXXPQIXJPDRBSD-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine?
The IUPAC name of (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine (CID 130511719) is (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine.
What is the SMILES notation for (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine?
The canonical SMILES for (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine is CCC(C)C1(C)OCC(CN)O1.
What is the InChIKey of (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine?
The InChIKey is PXXPQIXJPDRBSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-4-7(2)9(3)11-6-8(5-10)12-9/h7-8H,4-6,10H2,1-3H3.
What are the key properties of (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine?
(2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine has a molecular weight of 173.26 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-butan-2-yl-2-methyl-1,3-dioxolan-4-yl)methanamine is sourced from PubChem (CID 130511719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).