About 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole
2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole (PubChem CID 130511764) has the molecular formula C11H9NS2
and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole.
Molecular Properties
| Compound Name | 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole |
| PubChem CID | 130511764 |
| Molecular Formula | C11H9NS2 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.02 |
| IUPAC Name | 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole |
| SMILES | Cc1nc2c(s1)CSc1ccccc1-2 |
| InChI | InChI=1S/C11H9NS2/c1-7-12-11-8-4-2-3-5-9(8)13-6-10(11)14-7/h2-5H,6H2,1H3 |
| InChIKey | DZDUCVKFCPLOSM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole?
The IUPAC name of 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole (CID 130511764) is 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole.
What is the SMILES notation for 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole?
The canonical SMILES for 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole is Cc1nc2c(s1)CSc1ccccc1-2.
What is the InChIKey of 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole?
The InChIKey is DZDUCVKFCPLOSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9NS2/c1-7-12-11-8-4-2-3-5-9(8)13-6-10(11)14-7/h2-5H,6H2,1H3.
What are the key properties of 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole?
2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole has a molecular weight of 219.33 g/mol, XLogP of 3.72, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4H-thiochromeno[4,3-d][1,3]thiazole is sourced from PubChem (CID 130511764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).