About 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole
2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole (PubChem CID 130511793) has the molecular formula C8H8N2S2
and a molecular weight of 196.30 g/mol. Its IUPAC name is 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole |
| PubChem CID | 130511793 |
| Molecular Formula | C8H8N2S2 |
| Molecular Weight | 196.30 g/mol |
| Exact Mass | 196.01 |
| IUPAC Name | 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole |
| SMILES | Cc1nc(-c2cscn2)c(C)s1 |
| InChI | InChI=1S/C8H8N2S2/c1-5-8(10-6(2)12-5)7-3-11-4-9-7/h3-4H,1-2H3 |
| InChIKey | QXYBHZAITROBEV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.30 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole?
The IUPAC name of 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole (CID 130511793) is 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole.
What is the SMILES notation for 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole?
The canonical SMILES for 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole is Cc1nc(-c2cscn2)c(C)s1.
What is the InChIKey of 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole?
The InChIKey is QXYBHZAITROBEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2S2/c1-5-8(10-6(2)12-5)7-3-11-4-9-7/h3-4H,1-2H3.
What are the key properties of 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole?
2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole has a molecular weight of 196.30 g/mol, XLogP of 2.88, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-4-(1,3-thiazol-4-yl)-1,3-thiazole is sourced from PubChem (CID 130511793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).